N-carbamoylmaleamic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

N-carbamoylmaleamic acid
CAS RN:[105-61-3]
Formula:C5H6N2O4; 158.11 g/mol
InChiKey:GWGLGTKSTGSWGQ-UPHRSURJSA-N
SMILES:NC(=O)NC(=O)C=C/C(O)=O
Molecular structure of N-carbamoylmaleamic acid
Melting point:158 °C

Isomers

N-carbamoylmaleamic acid
Molecular structure of N-carbamoylmaleamic acid
L-dihydroorotic acid
Molecular structure of L-dihydroorotic acid
hydantoin-5-acetic acid
Molecular structure of hydantoin-5-acetic acid
D-hydroorotic acid
Molecular structure of D-hydroorotic acid
ibotenic acid
Molecular structure of ibotenic acid
methyl 4-methylfurazancarboxylate 2-oxide
Molecular structure of methyl 4-methylfurazancarboxylate 2-oxide
  ::